Create Ruby (others accepted) script that links Mumble to Discourse's user db
New here? Learn about Bountify and follow @bountify to get notified of new bounties! x

I would like my Mumble (Murmur) server to use my Discourse forum's user and group information for authentication.

There is currently a python script that does exactly what I need but for phpBB. There are also others and some more information about these authenticators located on the Mumble wiki.

Creating a Discourse plugin is also an option. I'm not sure if the functionality is possible within Discourse's plugin structure but I will leave that open to you.

There's a thread on the Discourse forums with a lot of information about this issue along with some initial help with the Discourse user passwords.

This script should be able to be run and daemonized on our either our Mumble server or our Discourse server and connect to the other one via Digital Ocean's private networking.

  • Users should use their username and password from Discourse to authenticate to Mumble.
  • Discourse's user Groups should be accessible from Mumble's ACL, e.g. @staff, @trust_level_1, etc.
  • The Mumble SuperUser should be kept in tact or should be set to a configurable user in the script.
  • Bonus: Support for user avatars and additional metadata like titles.

I would prefer a Ruby script since most of our tech is Ruby but I'm willing to accept other solutions to this problem.


  • functional script that links both Users and Groups from Discourse to Mumble (obviously)
  • a config file or config area of the script where values like ip can be set
  • detailed README with installation, running, and daemonization (unless written as a Discourse plugin) notes
  • suggested setup in terms of running it on the mumble server or discourse server
awarded to Elberet

Crowdsource coding tasks.

1 Solution

Winning solution

See thread at and code at Github Gists.

Full code as per Bountify guidelines:

#!/usr/bin/env python
# -*- coding: utf-8

# Copyright (C) 2009-2010 Stefan Hacker <>
# All rights reserved.
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions
# are met:

# - Redistributions of source code must retain the above copyright notice,
#   this list of conditions and the following disclaimer.
# - Redistributions in binary form must reproduce the above copyright notice,
#   this list of conditions and the following disclaimer in the documentation
#   and/or other materials provided with the distribution.
# - Neither the name of the Mumble Developers nor the names of its
#   contributors may be used to endorse or promote products derived from this
#   software without specific prior written permission.


# Modified for Discourse by (C) 2014 Jens Maier <>

# - Authenticator implementation for password authenticating
#                    a Murmur server against a discourse forum database
#    Requirements:
#        * python >=2.4 and the following python modules:
#            * ice-python
#            * MySQLdb
#            * daemon (when run as a daemon)

import sys
import Ice
import thread
import urllib2
import logging
import ConfigParser

from threading  import Timer
from optparse   import OptionParser
from logging    import (debug,

from xml.sax.saxutils import escape

from hashlib import sha256
from math import ceil
from hmac import new as hmac
from struct import pack, calcsize

def x2bool(s):
    """Helper function to convert strings from the config to bool"""
    if isinstance(s, bool):
        return s
    elif isinstance(s, basestring):
        return s.lower() in ['1', 'true']
    raise ValueError()

#--- Default configuration values
cfgfile = 'discourseauth.ini'
default = {'database':(('lib', str, 'psycopg2'),
                       ('name', str, 'discourse'),
                       ('user', str, 'discourse_user'),
                       ('password', str, 'discourse_password'),
                       ('host', str, ''),
                       ('port', int, 5432)),

            'user':(('id_offset', int, 1000000000),
                    ('avatar_enable', x2bool, True),
                    ('avatar_path', str, ''),
                    ('reject_on_error', x2bool, True)),

            'ice':(('host', str, ''),
                   ('port', int, 6502),
                   ('slice', str, '/usr/share/murmur/'),
                   ('secret', str, 'secret'),
                   ('watchdog', int, 30)),


            'murmur':(('servers', lambda x:map(int, x.split(',')), []),),
            'glacier':(('enabled', x2bool, False),
                       ('user', str, 'discourseauth'),
                       ('password', str, 'secret'),
                       ('host', str, 'localhost'),
                       ('port', int, '4063')),

            'log':(('level', int, logging.DEBUG),
                   ('file', str, 'discourseauth.log'))}

#--- Helper classes
class config(object):
    Small abstraction for config loading

    def __init__(self, filename = None, default = None):
        if not filename or not default: return
        cfg = ConfigParser.ConfigParser()
        cfg.optionxform = str

        for h,v in default.iteritems():
            if not v:
                # Output this whole section as a list of raw key/value tuples
                    self.__dict__[h] = cfg.items(h)
                except ConfigParser.NoSectionError:
                    self.__dict__[h] = []
                self.__dict__[h] = config()
                for name, conv, vdefault in v:
                        self.__dict__[h].__dict__[name] = conv(cfg.get(h, name))
                    except (ValueError, ConfigParser.NoSectionError, ConfigParser.NoOptionError):
                        self.__dict__[h].__dict__[name] = vdefault

class threadDbException(Exception): pass
class threadDB(object):
    Small abstraction to handle database connections for multiple

    db_connections = {}

    def connection(cls):
        tid = thread.get_ident()
            con = cls.db_connections[tid]
            info('Connecting to database server (%s %s:%d %s) for thread %d',
                 cfg.database.lib,, cfg.database.port,, tid)

                con = db.connect(host =,
                                   port = cfg.database.port,
                                   user = cfg.database.user,
                                   password = cfg.database.password,
                                   dbname =


            except db.Error, e:
                error('Could not connect to database: %s', str(e))
                raise threadDbException()
            cls.db_connections[tid] = con
        return con
    connection = classmethod(connection)

    def cursor(cls):
        return cls.connection().cursor()
    cursor = classmethod(cursor)

    def execute(cls, sql, *args, **kwargs):
        if "threadDB__retry_execution__" in kwargs:
            # Have a magic keyword so we can call ourselves while preventing
            # an infinite loop
            del kwargs["threadDB__retry_execution__"]
            retry = False
            retry = True

        c = cls.cursor()
            c.execute(sql, args, **kwargs)
        except db.OperationalError, e:
            error('Database operational error %d: %s', e.args[0], e.args[1])
            if retry:
                # Make sure we only retry once
                info('Retrying database operation')
                kwargs["threadDB__retry_execution__"] = True
                c = cls.execute(*args, **kwargs)
                error('Database operation failed ultimately')
                raise threadDbException()
        return c
    execute = classmethod(execute)

    def invalidate_connection(cls):
        tid = thread.get_ident()
        con = cls.db_connections.pop(tid, None)
        if con:
            debug('Invalidate connection to database for thread %d', tid)

    invalidate_connection = classmethod(invalidate_connection)

    def disconnect(cls):
        while cls.db_connections:
            tid, con = cls.db_connections.popitem()
            debug('Close database connection for thread %d', tid)
    disconnect = classmethod(disconnect)

def do_main_program():
    #--- Authenticator implementation
    #    All of this has to go in here so we can correctly daemonize the tool
    #    without loosing the file descriptors opened by the Ice module
    slicedir = Ice.getSliceDir()
    if not slicedir:
        slicedir = ["-I/usr/share/Ice/slice", "-I/usr/share/slice"]
        slicedir = ['-I' + slicedir]
    Ice.loadSlice('', slicedir + [])
    import Murmur

    class discourseauthenticatorApp(Ice.Application):
        def run(self, args):

            if not self.initializeIceConnection():
                return 1

            if > 0:
                self.failedWatch = True

            # Serve till we are stopped

            if self.interrupted():
                warning('Caught interrupt, shutting down')

            return 0

        def initializeIceConnection(self):
            Establishes the two-way Ice connection and adds the authenticator to the
            configured servers
            ice = self.communicator()

                debug('Using shared ice secret')
            elif not cfg.glacier.enabled:
                warning('Consider using an ice secret to improve security')

            if cfg.glacier.enabled:
                #info('Connecting to Glacier2 server (%s:%d)', glacier_host, glacier_port)
                error('Glacier support not implemented yet')
                #TODO: Implement this

            info('Connecting to Ice server (%s:%d)',,
            base = ice.stringToProxy('Meta:tcp -h %s -p %d' % (,
            self.meta = Murmur.MetaPrx.uncheckedCast(base)

            adapter = ice.createObjectAdapterWithEndpoints('Callback.Client', 'tcp -h %s' %

            metacbprx = adapter.addWithUUID(metaCallback(self))
            self.metacb = Murmur.MetaCallbackPrx.uncheckedCast(metacbprx)

            authprx = adapter.addWithUUID(discourseauthenticator())
            self.auth = Murmur.ServerUpdatingAuthenticatorPrx.uncheckedCast(authprx)

            return self.attachCallbacks()

        def attachCallbacks(self, quiet = False):
            Attaches all callbacks for meta and authenticators

            # Ice.ConnectionRefusedException
            #debug('Attaching callbacks')
                if not quiet: info('Attaching meta callback')


                for server in self.meta.getBootedServers():
                    if not cfg.murmur.servers or in cfg.murmur.servers:
                        if not quiet: info('Setting authenticator for virtual server %d',

            except (Murmur.InvalidSecretException, Ice.UnknownUserException, Ice.ConnectionRefusedException), e:
                if isinstance(e, Ice.ConnectionRefusedException):
                    error('Server refused connection')
                elif isinstance(e, Murmur.InvalidSecretException) or \
                     isinstance(e, Ice.UnknownUserException) and (e.unknown == 'Murmur::InvalidSecretException'):
                    error('Invalid ice secret')
                    # We do not actually want to handle this one, re-raise it
                    raise e

                self.connected = False
                return False

            self.connected = True
            return True

        def checkConnection(self):
            Tries reapplies all callbacks to make sure the authenticator
            survives server restarts and disconnects.
            #debug('Watchdog run')

                if not self.attachCallbacks(quiet = not self.failedWatch):
                    self.failedWatch = True
                    self.failedWatch = False
            except Ice.Exception, e:
                error('Failed connection check, will retry in next watchdog run (%ds)',
                self.failedWatch = True

            # Renew the timer
            self.watchdog = Timer(, self.checkConnection)

    def checkSecret(func):
        Decorator that checks whether the server transmitted the right secret
        if a secret is supposed to be used.
        if not
            return func

        def newfunc(*args, **kws):
            if 'current' in kws:
                current = kws["current"]
                current = args[-1]

            if not current or 'secret' not in current.ctx or current.ctx['secret'] !=
                error('Server transmitted invalid secret. Possible injection attempt.')
                raise Murmur.InvalidSecretException()

            return func(*args, **kws)

        return newfunc

    def fortifyIceFu(retval = None, exceptions = (Ice.Exception,)):
        Decorator that catches exceptions,logs them and returns a safe retval
        value. This helps preventing the authenticator getting stuck in
        critical code paths. Only exceptions that are instances of classes
        given in the exceptions list are not caught.

        The default is to catch all non-Ice exceptions.
        def newdec(func):
            def newfunc(*args, **kws):
                    return func(*args, **kws)
                except Exception, e:
                    catch = True
                    for ex in exceptions:
                        if isinstance(e, ex):
                            catch = False

                    if catch:
                        critical('Unexpected exception caught')
                        return retval

            return newfunc
        return newdec

    class metaCallback(Murmur.MetaCallback):
        def __init__(self, app):
   = app

        def started(self, server, current = None):
            This function is called when a virtual server is started
            and makes sure an authenticator gets attached if needed.
            if not cfg.murmur.servers or in cfg.murmur.servers:
                info('Setting authenticator for virtual server %d',
                # Apparently this server was restarted without us noticing
                except (Murmur.InvalidSecretException, Ice.UnknownUserException), e:
                    if hasattr(e, "unknown") and e.unknown != "Murmur::InvalidSecretException":
                        # Special handling for Murmur 1.2.2 servers with invalid slice files
                        raise e

                    error('Invalid ice secret')
                debug('Virtual server %d got started',

        def stopped(self, server, current = None):
            This function is called when a virtual server is stopped
                # Only try to output the server id if we think we are still connected to prevent
                # flooding of our thread pool
                    if not cfg.murmur.servers or in cfg.murmur.servers:
                        info('Authenticated virtual server %d got stopped',
                        debug('Virtual server %d got stopped',
                except Ice.ConnectionRefusedException:
           = False

            debug('Server shutdown stopped a virtual server')

    if cfg.user.reject_on_error: # Python 2.4 compat
        authenticateFortifyResult = (-1, None, None)
        authenticateFortifyResult = (-2, None, None)

    class discourseauthenticator(Murmur.ServerUpdatingAuthenticator):
        texture_cache = {}
        def __init__(self):

        def authenticate(self, name, pw, certlist, certhash, strong, current = None):
            This function is called to authenticate a user

            # Search for the user in the database
            FALL_THROUGH = -2
            AUTH_REFUSED = -1

            if name == 'SuperUser':
                debug('Forced fall through for SuperUser')
                return (FALL_THROUGH, None, None)

                sql = 'SELECT id, password_hash, salt, username FROM users WHERE LOWER(username)=LOWER(%s) AND active=TRUE AND id>0'
                cur = threadDB.execute(sql, name)
            except threadDbException:
                return (FALL_THROUGH, None, None)

            res = cur.fetchone()
            if not res:
                info('Fall through for unknown user "%s"', name)
                return (FALL_THROUGH, None, None)

            uid, upw, salt, unm = res
            if discourse_check_hash(pw, salt, upw):
                # Authenticated, fetch group memberships
                    sql = 'SELECT FROM group_users AS gu JOIN groups AS g ON gu.group_id = WHERE gu.user_id = %s'
                    cur = threadDB.execute(sql, uid)
                except threadDbException:
                    return (FALL_THROUGH, None, None)

                res = cur.fetchall()
                if res:
                    res = [a[0] for a in res]

                info('User authenticated: "%s" (%d)', name, uid + cfg.user.id_offset)
                debug('Group memberships: %s', str(res))
                return (uid + cfg.user.id_offset, name, res)

            info('Failed authentication attempt for user: "%s" (%d)', name, uid + cfg.user.id_offset)
            return (AUTH_REFUSED, None, None)

        @fortifyIceFu((False, None))
        def getInfo(self, id, current = None):
            Gets called to fetch user specific information

            # We do not expose any additional information so always fall through
            debug('getInfo for %d -> denied', id)
            return (False, None)

        def nameToId(self, name, current = None):
            Gets called to get the id for a given username

            FALL_THROUGH = -2
            if name == 'SuperUser':
                debug('nameToId SuperUser -> forced fall through')
                return FALL_THROUGH

                sql = 'SELECT id FROM users WHERE LOWER(username) = LOWER(%s) AND id > 0'
                cur = threadDB.execute(sql, name)
            except threadDbException:
                return FALL_THROUGH

            res = cur.fetchone()
            if not res:
                debug('nameToId %s -> ?', name)
                return FALL_THROUGH

            debug('nameToId %s -> %d', name, (res[0] + cfg.user.id_offset))
            return res[0] + cfg.user.id_offset

        def idToName(self, id, current = None):
            Gets called to get the username for a given id

            FALL_THROUGH = ""
            # Make sure the ID is in our range and transform it to the actual discourse user id
            if id < cfg.user.id_offset:
                return FALL_THROUGH 
            bbid = id - cfg.user.id_offset

            # Fetch the user from the database
                sql = 'SELECT username FROM users WHERE id = %s'
                cur = threadDB.execute(sql, bbid)
            except threadDbException:
                return FALL_THROUGH

            res = cur.fetchone()
            if res:
                if res[0] == 'SuperUser':
                    debug('idToName %d -> "SuperUser" catched')
                    return FALL_THROUGH

                debug('idToName %d -> "%s"', id, res[0])
                return res[0]

            debug('idToName %d -> ?', id)
            return FALL_THROUGH

        def idToTexture(self, id, current = None):
            Gets called to get the corresponding texture for a user

            FALL_THROUGH = ""

            debug('idToTexture for %d', id)
            if id < cfg.user.id_offset or not cfg.user.avatar_enable:
                debug('idToTexture %d -> fall through', id)
                return FALL_THROUGH

            # Otherwise get the users texture from discourse
            bbid = id - cfg.user.id_offset
                sql = 'SELECT username, uploaded_avatar_template FROM users WHERE id = %s AND use_uploaded_avatar = TRUE'
                cur = threadDB.execute(sql, bbid)
            except threadDbException:
                return FALL_THROUGH

            res = cur.fetchone()
            if not res:
                debug('idToTexture %d -> user unknown or no uploaded avatar, fall through', id)
                return FALL_THROUGH
            username, avatar_file = res

            if avatar_file in self.texture_cache:
                return self.texture_cache[avatar_file]

            url = cfg.user.avatar_path + avatar_file.replace("{size}", "%d" % 32)

                handle = urllib2.urlopen(url)
                file =
            except urllib2.URLError, e:
                warning('Image download for "%s" (%d) failed: %s', url, id, str(e))
                return FALL_THROUGH

            self.texture_cache[avatar_file] = file

            return self.texture_cache[avatar_file]

        def registerUser(self, name, current = None):
            Gets called when the server is asked to register a user.

            FALL_THROUGH = -2
            debug('registerUser "%s" -> fall through', name)
            return FALL_THROUGH

        def unregisterUser(self, id, current = None):
            Gets called when the server is asked to unregister a user.

            FALL_THROUGH = -1
            # Return -1 to fall through to internal server database, we will not modify the discourse database
            # but we can make murmur delete all additional information it got this way.
            debug('unregisterUser %d -> fall through', id)
            return FALL_THROUGH

        def getRegisteredUsers(self, filter, current = None):
            Returns a list of usernames in the discourse database which contain
            filter as a substring.

            if not filter:
                filter = '%'

                sql = 'SELECT id, username FROM users WHERE id > 0 AND username LIKE %s'
                cur = threadDB.execute(sql, filter)
            except threadDbException:
                return {}

            res = cur.fetchall()
            if not res:
                debug('getRegisteredUsers -> empty list for filter "%s"', filter)
                return {}
            debug ('getRegisteredUsers -> %d results for filter "%s"', len(res), filter)
            return dict([(a + cfg.user.id_offset, b) for a,b in res])

        def setInfo(self, id, info, current = None):
            Gets called when the server is supposed to save additional information
            about a user to his database

            FALL_THROUGH = -1
            # Return -1 to fall through to the internal server handler. We must not modify
            # the discourse database so the additional information is stored in murmurs database
            debug('setInfo %d -> fall through', id)
            return FALL_THROUGH

        def setTexture(self, id, texture, current = None):
            Gets called when the server is asked to update the user texture of a user

            FAILED = 0
            FALL_THROUGH = -1

            if id < cfg.user.id_offset:
                debug('setTexture %d -> fall through', id)
                return FALL_THROUGH

            if cfg.user.avatar_enable:
                # Report a fail (0) as we will not update the avatar in the discourse database.
                debug('setTexture %d -> failed', id)
                return FAILED

            # If we don't use textures from discourse we let mumble save it
            debug('setTexture %d -> fall through', id)
            return FALL_THROUGH

    class CustomLogger(Ice.Logger):
        Logger implementation to pipe Ice log messages into
        out own log

        def __init__(self):
            self._log = getLogger('Ice')

        def _print(self, message):

        def trace(self, category, message):
            self._log.debug('Trace %s: %s', category, message)

        def warning(self, message):

        def error(self, message):

    #--- Start of authenticator
    info('Starting discourse mumble authenticator')
    initdata = Ice.InitializationData() = Ice.createProperties([],
    for prop, val in cfg.iceraw:, val)'Ice.ImplicitContext', 'Shared')
    initdata.logger = CustomLogger()

    app = discourseauthenticatorApp()
    state = app.main(sys.argv[:1], initData = initdata)
    info('Shutdown complete')

#--- Python implementation of the discourse check hash function (salted md5)
def pbkdf2prf(key, msg, hashfunc=sha256):
    return hmac(key, msg, hashfunc).digest()

def byte2hex(bytestr):
    r = ''.join(["%02X" % ord(x) for x in bytestr]).strip()
    return r.lower()

def pbkdf2(password, salt, count=64000, dklen=32, hashfunc=sha256):
    hlen = hashfunc().digest_size
    maxdklen = (2**32-1) * hlen
    assert dklen < maxdklen, 'derived key too long'

    l = int(ceil(float(dklen)/hlen))
    r = dklen - (l-1) * hlen

    assert calcsize("!L") == 4, "iterator should be big-endian 4 byte string"

    dk = ''
    for i in xrange(1, l+1):
        U = pbkdf2prf(password, salt + pack("!L",i), hashfunc)
        tmp_key = U
        for _ in xrange(count-1):
            U = pbkdf2prf(password, U, hashfunc)
            tmp_key = "".join([chr(ord(x)^ord(y)) for (x,y) in zip(tmp_key,U)])
        dk += tmp_key

    return byte2hex(dk[:dklen])

def discourse_check_hash(password, salt, hash):
    Python implementation of the discourse check hash function

    # discourse conditions the password it got from the user before using it, replicate that

    return pbkdf2(password, salt) == hash

#--- Start of program
if __name__ == '__main__':
    # Parse commandline options
    parser = OptionParser()
    parser.add_option('-i', '--ini',
                      help = 'load configuration from INI', default = cfgfile)
    parser.add_option('-v', '--verbose', action='store_true', dest = 'verbose',
                      help = 'verbose output [default]', default = True)
    parser.add_option('-q', '--quiet', action='store_false', dest = 'verbose',
                      help = 'only error output')
    parser.add_option('-d', '--daemon', action='store_true', dest = 'force_daemon',
                      help = 'run as daemon', default = False)
    parser.add_option('-a', '--app', action='store_true', dest = 'force_app',
                      help = 'do not run as daemon', default = False)
    (option, args) = parser.parse_args()

    if option.force_daemon and option.force_app:

    # Load configuration
        cfg = config(option.ini, default)
    except Exception, e:
        print>>sys.stderr, 'Fatal error, could not load config file from "%s"' % cfgfile

        db = __import__(cfg.database.lib)
    except ImportError, e:
        print>>sys.stderr, 'Fatal error, could not import database library "%s", '\
        'please install the missing dependency and restart the authenticator' % cfg.database.lib

    # Initialize logger
    if cfg.log.file:
            logfile = open(cfg.log.file, 'a')
        except IOError, e:
            #print>>sys.stderr, str(e)
            print>>sys.stderr, 'Fatal error, could not open logfile "%s"' % cfg.log.file
        logfile = logging.sys.stderr

    if option.verbose:
        level = cfg.log.level
        level = logging.ERROR

    logging.basicConfig(level = level,
                        format='%(asctime)s %(levelname)s %(message)s',
                        stream = logfile)

    # As the default try to run as daemon. Silently degrade to running as a normal application if this fails
    # unless the user explicitly defined what he expected with the -a / -d parameter. 
        if option.force_app:
            raise ImportError # Pretend that we couldn't import the daemon lib
        import daemon
    except ImportError:
        if option.force_daemon:
            print>>sys.stderr, 'Fatal error, could not daemonize process due to missing "daemon" library, ' \
            'please install the missing dependency and restart the authenticator'
        context = daemon.DaemonContext(working_directory = sys.path[0],
                                       stderr = logfile)
            context.__exit__(None, None, None)
Bountify isn't that aggressive about its guidelines. Posting a gist or even linking to a repo of the script is sufficient.
akshatpradhan almost 6 years ago